C19H12IN — CID 144968877
3-(4-iodophenyl)phenanthridine (PubChem CID 144968877) has the molecular formula C19H12IN and a molecular weight of 381.22 g/mol. Its IUPAC name is 3-(4-iodophenyl)phenanthridine.
| Compound Name | 3-(4-iodophenyl)phenanthridine |
|---|---|
| PubChem CID | 144968877 |
| Molecular Formula | C19H12IN |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-(4-iodophenyl)phenanthridine |
| SMILES | Ic1ccc(-c2ccc3c(c2)ncc2ccccc23)cc1 |
| InChI | InChI=1S/C19H12IN/c20-16-8-5-13(6-9-16)14-7-10-18-17-4-2-1-3-15(17)12-21-19(18)11-14/h1-12H |
| InChIKey | DUKFHPIZDYRDHC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|