C29H28 — CID 144969308
1-methyl-5-[(2E,4Z,6Z)-4-(2-phenylprop-2-enylidene)nona-2,6,8-trien-2-yl]naphthalene (PubChem CID 144969308) has the molecular formula C29H28 and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-methyl-5-[(2E,4Z,6Z)-4-(2-phenylprop-2-enylidene)nona-2,6,8-trien-2-yl]naphthalene.
| Compound Name | 1-methyl-5-[(2E,4Z,6Z)-4-(2-phenylprop-2-enylidene)nona-2,6,8-trien-2-yl]naphthalene |
|---|---|
| PubChem CID | 144969308 |
| Molecular Formula | C29H28 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-methyl-5-[(2E,4Z,6Z)-4-(2-phenylprop-2-enylidene)nona-2,6,8-trien-2-yl]naphthalene |
| SMILES | C=C/C=C\CC(=C/C(=C)c1ccccc1)/C=C(\C)c1cccc2c(C)cccc12 |
| InChI | InChI=1S/C29H28/c1-5-6-8-14-25(20-23(3)26-15-9-7-10-16-26)21-24(4)28-18-12-17-27-22(2)13-11-19-29(27)28/h5-13,15-21H,1,3,14H2,2,4H3/b8-6-,24-21+,25-20- |
| InChIKey | DEVQFHXGPWFAIJ-JHTOZXPNSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|