C30H32N4O2 — CID 144973280
acetylene;butane;2-hydroxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile (PubChem CID 144973280) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is acetylene;butane;2-hydroxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile.
| Compound Name | acetylene;butane;2-hydroxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 144973280 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | acetylene;butane;2-hydroxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]benzonitrile |
| SMILES | C#C.CCCC.N#Cc1cc(-c2ccnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)ccc1O |
| InChI | InChI=1S/C24H20N4O2.C4H10.C2H2/c25-15-18-13-17(3-6-23(18)29)20-7-8-26-24-21(20)14-22(27-24)16-1-4-19(5-2-16)28-9-11-30-12-10-28;1-3-4-2;1-2/h1-8,13-14,29H,9-12H2,(H,26,27);3-4H2,1-2H3;1-2H |
| InChIKey | SODXFBATAVVXRT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|