C38H42N4O3S — CID 144973141
benzenethiol;ethane;5-[2-[4-(morpholin-4-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 144973141) has the molecular formula C38H42N4O3S and a molecular weight of 634.85 g/mol. Its IUPAC name is benzenethiol;ethane;5-[2-[4-(morpholin-4-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | benzenethiol;ethane;5-[2-[4-(morpholin-4-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 144973141 |
| Molecular Formula | C38H42N4O3S |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | benzenethiol;ethane;5-[2-[4-(morpholin-4-ylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | CC.N#Cc1cc(-c2ccnc3[nH]c(-c4ccc(CN5CCOCC5)cc4)cc23)ccc1OC1CCOCC1.Sc1ccccc1 |
| InChI | InChI=1S/C30H30N4O3.C6H6S.C2H6/c31-19-24-17-23(5-6-29(24)37-25-8-13-35-14-9-25)26-7-10-32-30-27(26)18-28(33-30)22-3-1-21(2-4-22)20-34-11-15-36-16-12-34;7-6-4-2-1-3-5-6;1-2/h1-7,10,17-18,25H,8-9,11-16,20H2,(H,32,33);1-5,7H;1-2H3 |
| InChIKey | MDAMHUASEIRBFC-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|