C30H29N3O3S — CID 144973270
benzenethiol;5-[2-(3,6-dihydro-2H-pyran-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 144973270) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is benzenethiol;5-[2-(3,6-dihydro-2H-pyran-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | benzenethiol;5-[2-(3,6-dihydro-2H-pyran-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 144973270 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | benzenethiol;5-[2-(3,6-dihydro-2H-pyran-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc3[nH]c(C4=CCOCC4)cc23)ccc1OC1CCOCC1.Sc1ccccc1 |
| InChI | InChI=1S/C24H23N3O3.C6H6S/c25-15-18-13-17(1-2-23(18)30-19-6-11-29-12-7-19)20-3-8-26-24-21(20)14-22(27-24)16-4-9-28-10-5-16;7-6-4-2-1-3-5-6/h1-4,8,13-14,19H,5-7,9-12H2,(H,26,27);1-5,7H |
| InChIKey | OHRWRDKBSDEJMZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|