C33H31N3O4S — CID 144973187
benzenethiol;5-[2-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 144973187) has the molecular formula C33H31N3O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is benzenethiol;5-[2-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | benzenethiol;5-[2-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 144973187 |
| Molecular Formula | C33H31N3O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | benzenethiol;5-[2-(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | COc1ccc(-c2cc3c(-c4ccc(OC5CCOCC5)c(C#N)c4)ccnc3[nH]2)cc1OC.Sc1ccccc1 |
| InChI | InChI=1S/C27H25N3O4.C6H6S/c1-31-25-6-4-18(14-26(25)32-2)23-15-22-21(7-10-29-27(22)30-23)17-3-5-24(19(13-17)16-28)34-20-8-11-33-12-9-20;7-6-4-2-1-3-5-6/h3-7,10,13-15,20H,8-9,11-12H2,1-2H3,(H,29,30);1-5,7H |
| InChIKey | QQXUPQBRXCDRFB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|