C34H37N5O4 — CID 118537641
tert-butyl 4-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]piperidine-1-carboxylate (PubChem CID 118537641) has the molecular formula C34H37N5O4 and a molecular weight of 579.70 g/mol. Its IUPAC name is tert-butyl 4-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118537641 |
| Molecular Formula | C34H37N5O4 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | tert-butyl 4-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(-c3ccnc4[nH]c(-c5ccc(N6CCOCC6)cc5)cc34)cc2C#N)CC1 |
| InChI | InChI=1S/C34H37N5O4/c1-34(2,3)43-33(40)39-14-11-27(12-15-39)42-31-9-6-24(20-25(31)22-35)28-10-13-36-32-29(28)21-30(37-32)23-4-7-26(8-5-23)38-16-18-41-19-17-38/h4-10,13,20-21,27H,11-12,14-19H2,1-3H3,(H,36,37) |
| InChIKey | HIXMOLNZWSPJDL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|