C32H34N6O4 — CID 118537516
tert-butyl (3R)-3-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenoxy]pyrrolidine-1-carboxylate (PubChem CID 118537516) has the molecular formula C32H34N6O4 and a molecular weight of 566.66 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118537516 |
| Molecular Formula | C32H34N6O4 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | tert-butyl (3R)-3-[2-cyano-4-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyridin-7-yl]phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Oc2ccc(-c3ccnc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c34)cc2C#N)C1 |
| InChI | InChI=1S/C32H34N6O4/c1-32(2,3)42-31(39)38-13-11-25(20-38)41-27-9-6-22(18-23(27)19-33)26-10-12-34-30-28(26)35-29(36-30)21-4-7-24(8-5-21)37-14-16-40-17-15-37/h4-10,12,18,25H,11,13-17,20H2,1-3H3,(H,34,35,36)/t25-/m1/s1 |
| InChIKey | VWKNXOVPMCQFPJ-RUZDIDTESA-N |
| XLogP | 5.39 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|