C29H29N7O4 — CID 118537407
2-[(3R)-1-[(2S)-2-hydroxypropanoyl]pyrrolidin-3-yl]oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile (PubChem CID 118537407) has the molecular formula C29H29N7O4 and a molecular weight of 539.60 g/mol. Its IUPAC name is 2-[(3R)-1-[(2S)-2-hydroxypropanoyl]pyrrolidin-3-yl]oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile.
| Compound Name | 2-[(3R)-1-[(2S)-2-hydroxypropanoyl]pyrrolidin-3-yl]oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118537407 |
| Molecular Formula | C29H29N7O4 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 2-[(3R)-1-[(2S)-2-hydroxypropanoyl]pyrrolidin-3-yl]oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile |
| SMILES | C[C@H](O)C(=O)N1CC[C@@H](Oc2ccc(-c3ncnc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c34)cc2C#N)C1 |
| InChI | InChI=1S/C29H29N7O4/c1-18(37)29(38)36-9-8-23(16-36)40-24-7-4-20(14-21(24)15-30)25-26-28(32-17-31-25)34-27(33-26)19-2-5-22(6-3-19)35-10-12-39-13-11-35/h2-7,14,17-18,23,37H,8-13,16H2,1H3,(H,31,32,33,34)/t18-,23+/m0/s1 |
| InChIKey | GJYMEPWTRTXUKG-FDDCHVKYSA-N |
| XLogP | 2.76 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|