C32H34N8O4 — CID 137413194
2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile (PubChem CID 137413194) has the molecular formula C32H34N8O4 and a molecular weight of 594.68 g/mol. Its IUPAC name is 2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile.
| Compound Name | 2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 137413194 |
| Molecular Formula | C32H34N8O4 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(N5CCN(C6COC6)CC5)cc4)[nH]c23)ccc1OC1CCN(C(=O)CO)CC1 |
| InChI | InChI=1S/C32H34N8O4/c33-16-23-15-22(3-6-27(23)44-26-7-9-40(10-8-26)28(42)17-41)29-30-32(35-20-34-29)37-31(36-30)21-1-4-24(5-2-21)38-11-13-39(14-12-38)25-18-43-19-25/h1-6,15,20,25-26,41H,7-14,17-19H2,(H,34,35,36,37) |
| InChIKey | ZSCIUAAPWXBWIT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|