C30H31N7O3 — CID 118537734
2-(oxan-4-yloxy)-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile (PubChem CID 118537734) has the molecular formula C30H31N7O3 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-(oxan-4-yloxy)-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile.
| Compound Name | 2-(oxan-4-yloxy)-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118537734 |
| Molecular Formula | C30H31N7O3 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-(oxan-4-yloxy)-5-[8-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-purin-6-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(N5CCN(C6COC6)CC5)cc4)[nH]c23)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C30H31N7O3/c31-16-22-15-21(3-6-26(22)40-25-7-13-38-14-8-25)27-28-30(33-19-32-27)35-29(34-28)20-1-4-23(5-2-20)36-9-11-37(12-10-36)24-17-39-18-24/h1-6,15,19,24-25H,7-14,17-18H2,(H,32,33,34,35) |
| InChIKey | LZOUJBLQAAEDKK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|