C29H31N7O3 — CID 144973124
formaldehyde;2-(1-methylpiperidin-4-yl)oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile (PubChem CID 144973124) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is formaldehyde;2-(1-methylpiperidin-4-yl)oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile.
| Compound Name | formaldehyde;2-(1-methylpiperidin-4-yl)oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 144973124 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | formaldehyde;2-(1-methylpiperidin-4-yl)oxy-5-[8-(4-morpholin-4-ylphenyl)-7H-purin-6-yl]benzonitrile |
| SMILES | C=O.CN1CCC(Oc2ccc(-c3ncnc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c34)cc2C#N)CC1 |
| InChI | InChI=1S/C28H29N7O2.CH2O/c1-34-10-8-23(9-11-34)37-24-7-4-20(16-21(24)17-29)25-26-28(31-18-30-25)33-27(32-26)19-2-5-22(6-3-19)35-12-14-36-15-13-35;1-2/h2-7,16,18,23H,8-15H2,1H3,(H,30,31,32,33);1H2 |
| InChIKey | JZMIRBOPVVPDMT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|