C32H33N5O4 — CID 118552176
2-[4-(2-hydroxypropanoyl)cyclohexyl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-c]pyridin-4-yl]benzonitrile (PubChem CID 118552176) has the molecular formula C32H33N5O4 and a molecular weight of 551.65 g/mol. Its IUPAC name is 2-[4-(2-hydroxypropanoyl)cyclohexyl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-c]pyridin-4-yl]benzonitrile.
| Compound Name | 2-[4-(2-hydroxypropanoyl)cyclohexyl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-c]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118552176 |
| Molecular Formula | C32H33N5O4 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[4-(2-hydroxypropanoyl)cyclohexyl]oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-c]pyridin-4-yl]benzonitrile |
| SMILES | CC(O)C(=O)C1CCC(Oc2ccc(-c3nccc4[nH]c(-c5ccc(N6CCOCC6)cc5)nc34)cc2C#N)CC1 |
| InChI | InChI=1S/C32H33N5O4/c1-20(38)31(39)21-4-9-26(10-5-21)41-28-11-6-23(18-24(28)19-33)29-30-27(12-13-34-29)35-32(36-30)22-2-7-25(8-3-22)37-14-16-40-17-15-37/h2-3,6-8,11-13,18,20-21,26,38H,4-5,9-10,14-17H2,1H3,(H,35,36) |
| InChIKey | CIBPFAJPRIGZBC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|