C29H28N4O4S — CID 118551882
2-(1,1-dioxothian-4-yl)oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-c]pyridin-4-yl]benzonitrile (PubChem CID 118551882) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-c]pyridin-4-yl]benzonitrile.
| Compound Name | 2-(1,1-dioxothian-4-yl)oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-c]pyridin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 118551882 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)oxy-5-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[3,2-c]pyridin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2nccc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)ccc1OC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C29H28N4O4S/c30-19-22-17-21(3-6-28(22)37-24-8-15-38(34,35)16-9-24)29-25-18-27(32-26(25)7-10-31-29)20-1-4-23(5-2-20)33-11-13-36-14-12-33/h1-7,10,17-18,24,32H,8-9,11-16H2 |
| InChIKey | VMGCVJDZFZIRDE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|