C30H33N5O2 — CID 144973340
5-[2-[4-(4-methylpiperazin-1-yl)phenyl]-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 144973340) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 5-[2-[4-(4-methylpiperazin-1-yl)phenyl]-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-[4-(4-methylpiperazin-1-yl)phenyl]-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 144973340 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 5-[2-[4-(4-methylpiperazin-1-yl)phenyl]-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | CN1CCN(c2ccc(-c3cc4c([nH]3)NCC=C4c3ccc(OC4CCOCC4)c(C#N)c3)cc2)CC1 |
| InChI | InChI=1S/C30H33N5O2/c1-34-12-14-35(15-13-34)24-5-2-21(3-6-24)28-19-27-26(8-11-32-30(27)33-28)22-4-7-29(23(18-22)20-31)37-25-9-16-36-17-10-25/h2-8,18-19,25,32-33H,9-17H2,1H3 |
| InChIKey | XSIJJTPFGRVUIY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|