C31H31F2N7O2 — CID 118537348
5-[8-[4-[1-(2,2-difluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]-2-(1-formylpiperidin-4-yl)oxybenzonitrile (PubChem CID 118537348) has the molecular formula C31H31F2N7O2 and a molecular weight of 571.63 g/mol. Its IUPAC name is 5-[8-[4-[1-(2,2-difluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]-2-(1-formylpiperidin-4-yl)oxybenzonitrile.
| Compound Name | 5-[8-[4-[1-(2,2-difluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]-2-(1-formylpiperidin-4-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 118537348 |
| Molecular Formula | C31H31F2N7O2 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 5-[8-[4-[1-(2,2-difluoroethyl)piperidin-4-yl]phenyl]-7H-purin-6-yl]-2-(1-formylpiperidin-4-yl)oxybenzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3nc(-c4ccc(C5CCN(CC(F)F)CC5)cc4)[nH]c23)ccc1OC1CCN(C=O)CC1 |
| InChI | InChI=1S/C31H31F2N7O2/c32-27(33)17-39-11-7-21(8-12-39)20-1-3-22(4-2-20)30-37-29-28(35-18-36-31(29)38-30)23-5-6-26(24(15-23)16-34)42-25-9-13-40(19-41)14-10-25/h1-6,15,18-19,21,25,27H,7-14,17H2,(H,35,36,37,38) |
| InChIKey | UAROTPQRUDFOGH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|