C34H39N5O4 — CID 137413215
tert-butyl (3R)-3-[2-(methyliminomethyl)-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]pyrrolidine-1-carboxylate (PubChem CID 137413215) has the molecular formula C34H39N5O4 and a molecular weight of 581.72 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-(methyliminomethyl)-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-(methyliminomethyl)-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 137413215 |
| Molecular Formula | C34H39N5O4 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | tert-butyl (3R)-3-[2-(methyliminomethyl)-4-[2-(4-morpholin-4-ylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]pyrrolidine-1-carboxylate |
| SMILES | C/N=C/c1cc(-c2ccnc3[nH]c(-c4ccc(N5CCOCC5)cc4)cc23)ccc1O[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C34H39N5O4/c1-34(2,3)43-33(40)39-14-12-27(22-39)42-31-10-7-24(19-25(31)21-35-4)28-11-13-36-32-29(28)20-30(37-32)23-5-8-26(9-6-23)38-15-17-41-18-16-38/h5-11,13,19-21,27H,12,14-18,22H2,1-4H3,(H,36,37)/b35-21+/t27-/m1/s1 |
| InChIKey | ZCULOTUNMSPLEA-UBJCUSJWSA-N |
| XLogP | 6.17 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|