C9H13NO — CID 144974462
(4Z)-6-(aminomethyl)-3-methylidenehepta-1,4,6-trien-2-ol (PubChem CID 144974462) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4Z)-6-(aminomethyl)-3-methylidenehepta-1,4,6-trien-2-ol.
| Compound Name | (4Z)-6-(aminomethyl)-3-methylidenehepta-1,4,6-trien-2-ol |
|---|---|
| PubChem CID | 144974462 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4Z)-6-(aminomethyl)-3-methylidenehepta-1,4,6-trien-2-ol |
| SMILES | C=C(/C=C\C(=C)C(=C)O)CN |
| InChI | InChI=1S/C9H13NO/c1-7(6-10)4-5-8(2)9(3)11/h4-5,11H,1-3,6,10H2/b5-4- |
| InChIKey | HUEYFIOVUHPXLC-PLNGDYQASA-N |
| XLogP | 1.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|