C29H33N7O3 — CID 144975081
1-[3-[4-amino-3-[4-[[[hydroxy-(2-methoxyphenyl)methyl]-methylamino]methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 144975081) has the molecular formula C29H33N7O3 and a molecular weight of 527.63 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[4-[[[hydroxy-(2-methoxyphenyl)methyl]-methylamino]methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[4-[[[hydroxy-(2-methoxyphenyl)methyl]-methylamino]methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 144975081 |
| Molecular Formula | C29H33N7O3 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 1-[3-[4-amino-3-[4-[[[hydroxy-(2-methoxyphenyl)methyl]-methylamino]methyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(CN(C)C(O)c4ccccc4OC)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C29H33N7O3/c1-4-24(37)35-15-7-8-21(17-35)36-28-25(27(30)31-18-32-28)26(33-36)20-13-11-19(12-14-20)16-34(2)29(38)22-9-5-6-10-23(22)39-3/h4-6,9-14,18,21,29,38H,1,7-8,15-17H2,2-3H3,(H2,30,31,32) |
| InChIKey | FJELFSKXMCFPSI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|