C21H32N2S — CID 144976990
N'-benzyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine (PubChem CID 144976990) has the molecular formula C21H32N2S and a molecular weight of 344.57 g/mol. Its IUPAC name is N'-benzyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 144976990 |
| Molecular Formula | C21H32N2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N'-benzyl-N-[3-[(2E)-2-ethenylpenta-2,4-dienyl]sulfanylpropyl]-N'-methylpropane-1,3-diamine |
| SMILES | C=C/C=C(\C=C)CSCCCNCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2S/c1-4-11-20(5-2)19-24-17-10-15-22-14-9-16-23(3)18-21-12-7-6-8-13-21/h4-8,11-13,22H,1-2,9-10,14-19H2,3H3/b20-11+ |
| InChIKey | KCDFELDYNKEGHE-RGVLZGJSSA-N |
| XLogP | 4.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|