C56H58 — CID 144979759
3'-ethyl-7-methyl-2'-[(Z)-prop-1-enyl]spiro[2,3-dihydrofluorene-9,1'-indene];1-methyl-2-phenylbenzene;1,1,2,6-tetramethyl-3-[(Z)-prop-1-enyl]indene (PubChem CID 144979759) has the molecular formula C56H58 and a molecular weight of 731.08 g/mol. Its IUPAC name is 3'-ethyl-7-methyl-2'-[(Z)-prop-1-enyl]spiro[2,3-dihydrofluorene-9,1'-indene];1-methyl-2-phenylbenzene;1,1,2,6-tetramethyl-3-[(Z)-prop-1-enyl]indene.
| Compound Name | 3'-ethyl-7-methyl-2'-[(Z)-prop-1-enyl]spiro[2,3-dihydrofluorene-9,1'-indene];1-methyl-2-phenylbenzene;1,1,2,6-tetramethyl-3-[(Z)-prop-1-enyl]indene |
|---|---|
| PubChem CID | 144979759 |
| Molecular Formula | C56H58 |
| Molecular Weight | 731.08 g/mol |
| Exact Mass | 730.45 |
| IUPAC Name | 3'-ethyl-7-methyl-2'-[(Z)-prop-1-enyl]spiro[2,3-dihydrofluorene-9,1'-indene];1-methyl-2-phenylbenzene;1,1,2,6-tetramethyl-3-[(Z)-prop-1-enyl]indene |
| SMILES | C/C=C\C1=C(C)C(C)(C)c2cc(C)ccc21.C/C=C\C1=C(CC)c2ccccc2C12C1=CCCC=C1c1ccc(C)cc12.Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H26.C16H20.C13H12/c1-4-10-23-19(5-2)20-11-6-8-13-24(20)27(23)25-14-9-7-12-21(25)22-16-15-18(3)17-26(22)27;1-6-7-13-12(3)16(4,5)15-10-11(2)8-9-14(13)15;1-11-7-5-6-10-13(11)12-8-3-2-4-9-12/h4,6,8,10-17H,5,7,9H2,1-3H3;6-10H,1-5H3;2-10H,1H3/b10-4-;7-6-; |
| InChIKey | PTEVQJBOXSRQMT-HKUFWXTISA-N |
| XLogP | 15.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.08 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |