C20H25N5O4 — CID 144981687
N'-(cyclobutanecarbonyl)-1-methylazetidine-3-carbohydrazide;5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 144981687) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is N'-(cyclobutanecarbonyl)-1-methylazetidine-3-carbohydrazide;5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N'-(cyclobutanecarbonyl)-1-methylazetidine-3-carbohydrazide;5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 144981687 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N'-(cyclobutanecarbonyl)-1-methylazetidine-3-carbohydrazide;5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CN1CC(C(=O)NNC(=O)C2CCC2)C1.NC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C10H17N3O2.C10H8N2O2/c1-13-5-8(6-13)10(15)12-11-9(14)7-3-2-4-7;11-10(13)8-6-9(14-12-8)7-4-2-1-3-5-7/h7-8H,2-6H2,1H3,(H,11,14)(H,12,15);1-6H,(H2,11,13) |
| InChIKey | ZNWYTEDRWWRXQM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|