C16H18N4O5S — CID 51111295
N'-(1-methylsulfonylpyrrolidine-2-carbonyl)-5-phenyl-1,2-oxazole-3-carbohydrazide (PubChem CID 51111295) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is N'-(1-methylsulfonylpyrrolidine-2-carbonyl)-5-phenyl-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-(1-methylsulfonylpyrrolidine-2-carbonyl)-5-phenyl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 51111295 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N'-(1-methylsulfonylpyrrolidine-2-carbonyl)-5-phenyl-1,2-oxazole-3-carbohydrazide |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)NNC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C16H18N4O5S/c1-26(23,24)20-9-5-8-13(20)16(22)18-17-15(21)12-10-14(25-19-12)11-6-3-2-4-7-11/h2-4,6-7,10,13H,5,8-9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | MBYOXDNXJDEQQV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|