C15H19N3O4S — CID 144981796
[4-[1-formyloxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]carbamothioic S-acid (PubChem CID 144981796) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is [4-[1-formyloxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]carbamothioic S-acid.
| Compound Name | [4-[1-formyloxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 144981796 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [4-[1-formyloxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]carbamothioic S-acid |
| SMILES | CN1CCN(C(=O)C(OC=O)c2ccc(NC(=O)S)cc2)CC1 |
| InChI | InChI=1S/C15H19N3O4S/c1-17-6-8-18(9-7-17)14(20)13(22-10-19)11-2-4-12(5-3-11)16-15(21)23/h2-5,10,13H,6-9H2,1H3,(H2,16,21,23) |
| InChIKey | KVRKGDHDAXYCNH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|