C18H27N3O3 — CID 170712384
[1-[3-(methylamino)phenyl]-2-(4-methylpiperazin-1-yl)-2-oxoethyl] 2-methylpropanoate (PubChem CID 170712384) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is [1-[3-(methylamino)phenyl]-2-(4-methylpiperazin-1-yl)-2-oxoethyl] 2-methylpropanoate.
| Compound Name | [1-[3-(methylamino)phenyl]-2-(4-methylpiperazin-1-yl)-2-oxoethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170712384 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [1-[3-(methylamino)phenyl]-2-(4-methylpiperazin-1-yl)-2-oxoethyl] 2-methylpropanoate |
| SMILES | CNc1cccc(C(OC(=O)C(C)C)C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-13(2)18(23)24-16(14-6-5-7-15(12-14)19-3)17(22)21-10-8-20(4)9-11-21/h5-7,12-13,16,19H,8-11H2,1-4H3 |
| InChIKey | VOTNQSNZORKNNB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |