C18H26N2O3 — CID 170712309
[[3-(4-methylpiperazin-1-yl)oxiran-2-yl]-phenylmethyl] 2-methylpropanoate (PubChem CID 170712309) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [[3-(4-methylpiperazin-1-yl)oxiran-2-yl]-phenylmethyl] 2-methylpropanoate.
| Compound Name | [[3-(4-methylpiperazin-1-yl)oxiran-2-yl]-phenylmethyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 170712309 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [[3-(4-methylpiperazin-1-yl)oxiran-2-yl]-phenylmethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(c1ccccc1)C1OC1N1CCN(C)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)18(21)23-15(14-7-5-4-6-8-14)16-17(22-16)20-11-9-19(3)10-12-20/h4-8,13,15-17H,9-12H2,1-3H3 |
| InChIKey | VHIGOEQJLGEGLG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|