C20H33N5O3 — CID 118612323
(2S)-2-amino-N-[4-[1-methoxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-5-(methylamino)pentanamide (PubChem CID 118612323) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[1-methoxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-5-(methylamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[4-[1-methoxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 118612323 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (2S)-2-amino-N-[4-[1-methoxy-2-(4-methylpiperazin-1-yl)-2-oxoethyl]phenyl]-5-(methylamino)pentanamide |
| SMILES | CNCCC[C@H](N)C(=O)Nc1ccc(C(OC)C(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H33N5O3/c1-22-10-4-5-17(21)19(26)23-16-8-6-15(7-9-16)18(28-3)20(27)25-13-11-24(2)12-14-25/h6-9,17-18,22H,4-5,10-14,21H2,1-3H3,(H,23,26)/t17-,18?/m0/s1 |
| InChIKey | UOQGNMSJULUJAU-ZENAZSQFSA-N |
| XLogP | 0.41 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|