methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate

C9H15N2O2+ — CID 144982225

IUPACmethyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate
SMILESCOC(=O)C[n+]1[nH]c(C)c(C)c1C
InChIInChI=1S/C9H14N2O2/c1-6-7(2)10-11(8(6)3)5-9(12)13-4/h5H2,1-4H3/p+1
InChIKeyBYEFIQUKLRVYEM-UHFFFAOYSA-O
MW183.23 g/mol
LogP0.40
Rot. Bonds2

About methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate

methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate (PubChem CID 144982225) has the molecular formula C9H15N2O2+ and a molecular weight of 183.23 g/mol. Its IUPAC name is methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate
PubChem CID144982225
Molecular FormulaC9H15N2O2+
Molecular Weight183.23 g/mol
Exact Mass183.11
IUPAC Namemethyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate
SMILESCOC(=O)C[n+]1[nH]c(C)c(C)c1C
InChIInChI=1S/C9H14N2O2/c1-6-7(2)10-11(8(6)3)5-9(12)13-4/h5H2,1-4H3/p+1
InChIKeyBYEFIQUKLRVYEM-UHFFFAOYSA-O
XLogP0.40
TPSA45.97 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.23
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate?
The IUPAC name of methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate (CID 144982225) is methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate.
What is the SMILES notation for methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate?
The canonical SMILES for methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate is COC(=O)C[n+]1[nH]c(C)c(C)c1C.
What is the InChIKey of methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate?
The InChIKey is BYEFIQUKLRVYEM-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H14N2O2/c1-6-7(2)10-11(8(6)3)5-9(12)13-4/h5H2,1-4H3/p+1.
What are the key properties of methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate?
methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate has a molecular weight of 183.23 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate is sourced from PubChem (CID 144982225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).