C9H15N2O2+ — CID 144982225
methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate (PubChem CID 144982225) has the molecular formula C9H15N2O2+ and a molecular weight of 183.23 g/mol. Its IUPAC name is methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate.
| Compound Name | methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate |
|---|---|
| PubChem CID | 144982225 |
| Molecular Formula | C9H15N2O2+ |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | methyl 2-(3,4,5-trimethyl-1H-pyrazol-2-ium-2-yl)acetate |
| SMILES | COC(=O)C[n+]1[nH]c(C)c(C)c1C |
| InChI | InChI=1S/C9H14N2O2/c1-6-7(2)10-11(8(6)3)5-9(12)13-4/h5H2,1-4H3/p+1 |
| InChIKey | BYEFIQUKLRVYEM-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|