C31H67NO7S2 — CID 14498262
methanesulfonate;3-[2-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)propyl]sulfonylpropyl-trimethylazanium (PubChem CID 14498262) has the molecular formula C31H67NO7S2 and a molecular weight of 630.01 g/mol. Its IUPAC name is methanesulfonate;3-[2-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)propyl]sulfonylpropyl-trimethylazanium.
| Compound Name | methanesulfonate;3-[2-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)propyl]sulfonylpropyl-trimethylazanium |
|---|---|
| PubChem CID | 14498262 |
| Molecular Formula | C31H67NO7S2 |
| Molecular Weight | 630.01 g/mol |
| Exact Mass | 629.44 |
| IUPAC Name | methanesulfonate;3-[2-methoxy-3-(3,7,11,15-tetramethylhexadecoxy)propyl]sulfonylpropyl-trimethylazanium |
| SMILES | COC(COCCC(C)CCCC(C)CCCC(C)CCCC(C)C)CS(=O)(=O)CCC[N+](C)(C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C30H64NO4S.CH4O3S/c1-26(2)14-10-15-27(3)16-11-17-28(4)18-12-19-29(5)20-22-35-24-30(34-9)25-36(32,33)23-13-21-31(6,7)8;1-5(2,3)4/h26-30H,10-25H2,1-9H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | HESJIBFWZWGHOF-UHFFFAOYSA-M |
| XLogP | 6.16 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.01 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|