C16H20F4N2O2 — CID 144984113
tert-butyl 4-fluoro-4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 144984113) has the molecular formula C16H20F4N2O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144984113 |
| Molecular Formula | C16H20F4N2O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | tert-butyl 4-fluoro-4-[6-(trifluoromethyl)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C16H20F4N2O2/c1-14(2,3)24-13(23)22-8-6-15(17,7-9-22)11-4-5-12(21-10-11)16(18,19)20/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | OAUIVBZGDPCSRD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |