C11H14N4 — CID 144986156
6-N-propylquinazoline-2,6-diamine (PubChem CID 144986156) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-N-propylquinazoline-2,6-diamine.
| Compound Name | 6-N-propylquinazoline-2,6-diamine |
|---|---|
| PubChem CID | 144986156 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 6-N-propylquinazoline-2,6-diamine |
| SMILES | CCCNc1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C11H14N4/c1-2-5-13-9-3-4-10-8(6-9)7-14-11(12)15-10/h3-4,6-7,13H,2,5H2,1H3,(H2,12,14,15) |
| InChIKey | NEEMUJAVVBZEDS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |