C16H16FNO — CID 144987094
2-fluoro-5-(5,6,7,8-tetrahydronaphthalen-2-ylamino)phenol (PubChem CID 144987094) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-fluoro-5-(5,6,7,8-tetrahydronaphthalen-2-ylamino)phenol.
| Compound Name | 2-fluoro-5-(5,6,7,8-tetrahydronaphthalen-2-ylamino)phenol |
|---|---|
| PubChem CID | 144987094 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-fluoro-5-(5,6,7,8-tetrahydronaphthalen-2-ylamino)phenol |
| SMILES | Oc1cc(Nc2ccc3c(c2)CCCC3)ccc1F |
| InChI | InChI=1S/C16H16FNO/c17-15-8-7-14(10-16(15)19)18-13-6-5-11-3-1-2-4-12(11)9-13/h5-10,18-19H,1-4H2 |
| InChIKey | DXGOOBKWOOSEMP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |