About 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol
4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol (PubChem CID 144987442) has the molecular formula C21H22O
and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol.
Molecular Properties
| Compound Name | 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol |
| PubChem CID | 144987442 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol |
| SMILES | C=C(C)O.C=C1C=C(c2ccccc2C)c2c(C)cccc21 |
| InChI | InChI=1S/C18H16.C3H6O/c1-12-7-4-5-9-15(12)17-11-14(3)16-10-6-8-13(2)18(16)17;1-3(2)4/h4-11H,3H2,1-2H3;4H,1H2,2H3 |
| InChIKey | BMVHACOCZXEYET-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol?
The IUPAC name of 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol (CID 144987442) is 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol.
What is the SMILES notation for 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol?
The canonical SMILES for 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol is C=C(C)O.C=C1C=C(c2ccccc2C)c2c(C)cccc21.
What is the InChIKey of 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol?
The InChIKey is BMVHACOCZXEYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16.C3H6O/c1-12-7-4-5-9-15(12)17-11-14(3)16-10-6-8-13(2)18(16)17;1-3(2)4/h4-11H,3H2,1-2H3;4H,1H2,2H3.
What are the key properties of 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol?
4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol has a molecular weight of 290.41 g/mol, XLogP of 5.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-methylidene-3-(2-methylphenyl)indene;prop-1-en-2-ol is sourced from PubChem (CID 144987442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).