C23H18F7N5O6 — CID 144987989
[[(4S,6S)-4-[2-fluoro-5-[3-[5-(2-hydroxyethoxy)pyrimidin-2-yl]-1,2-oxazol-5-yl]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]amino] 2,2,2-trifluoroacetate (PubChem CID 144987989) has the molecular formula C23H18F7N5O6 and a molecular weight of 593.41 g/mol. Its IUPAC name is [[(4S,6S)-4-[2-fluoro-5-[3-[5-(2-hydroxyethoxy)pyrimidin-2-yl]-1,2-oxazol-5-yl]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[(4S,6S)-4-[2-fluoro-5-[3-[5-(2-hydroxyethoxy)pyrimidin-2-yl]-1,2-oxazol-5-yl]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 144987989 |
| Molecular Formula | C23H18F7N5O6 |
| Molecular Weight | 593.41 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | [[(4S,6S)-4-[2-fluoro-5-[3-[5-(2-hydroxyethoxy)pyrimidin-2-yl]-1,2-oxazol-5-yl]phenyl]-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-yl]amino] 2,2,2-trifluoroacetate |
| SMILES | C[C@@]1(c2cc(-c3cc(-c4ncc(OCCO)cn4)no3)ccc2F)C[C@@H](C(F)(F)F)OC(NOC(=O)C(F)(F)F)=N1 |
| InChI | InChI=1S/C23H18F7N5O6/c1-21(8-17(22(25,26)27)39-20(33-21)35-41-19(37)23(28,29)30)13-6-11(2-3-14(13)24)16-7-15(34-40-16)18-31-9-12(10-32-18)38-5-4-36/h2-3,6-7,9-10,17,36H,4-5,8H2,1H3,(H,33,35)/t17-,21-/m0/s1 |
| InChIKey | ADWUMGTWRSYIBC-UWJYYQICSA-N |
| XLogP | 3.84 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|