C31H38Cl2FN3O3 — CID 144988439
(4S)-3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-2-N-(3-chlorophenyl)-1-[(3-ethoxyphenyl)methyl]-4-N,5-dimethylpyrrolidine-2,4-dicarboxamide;ethane (PubChem CID 144988439) has the molecular formula C31H38Cl2FN3O3 and a molecular weight of 590.57 g/mol. Its IUPAC name is (4S)-3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-2-N-(3-chlorophenyl)-1-[(3-ethoxyphenyl)methyl]-4-N,5-dimethylpyrrolidine-2,4-dicarboxamide;ethane.
| Compound Name | (4S)-3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-2-N-(3-chlorophenyl)-1-[(3-ethoxyphenyl)methyl]-4-N,5-dimethylpyrrolidine-2,4-dicarboxamide;ethane |
|---|---|
| PubChem CID | 144988439 |
| Molecular Formula | C31H38Cl2FN3O3 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | (4S)-3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-2-N-(3-chlorophenyl)-1-[(3-ethoxyphenyl)methyl]-4-N,5-dimethylpyrrolidine-2,4-dicarboxamide;ethane |
| SMILES | C=C(Cl)/C=C\C=C(/F)C1C(C(=O)Nc2cccc(Cl)c2)N(Cc2cccc(OCC)c2)C(C)[C@H]1C(=O)NC.CC |
| InChI | InChI=1S/C29H32Cl2FN3O3.C2H6/c1-5-38-23-13-7-10-20(15-23)17-35-19(3)25(28(36)33-4)26(24(32)14-6-9-18(2)30)27(35)29(37)34-22-12-8-11-21(31)16-22;1-2/h6-16,19,25-27H,2,5,17H2,1,3-4H3,(H,33,36)(H,34,37);1-2H3/b9-6-,24-14-;/t19?,25-,26?,27?;/m1./s1 |
| InChIKey | JSSQXDFGWZHOKU-NTLFFEORSA-N |
| XLogP | 7.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|