C32H34Cl2FN3O5 — CID 123587834
6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-(dihydroxymethyl)cyclopropyl]methyl]-4-[(3-ethoxyphenyl)methyl]-3a,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,3]oxazole-5-carboxamide (PubChem CID 123587834) has the molecular formula C32H34Cl2FN3O5 and a molecular weight of 630.54 g/mol. Its IUPAC name is 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-(dihydroxymethyl)cyclopropyl]methyl]-4-[(3-ethoxyphenyl)methyl]-3a,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,3]oxazole-5-carboxamide.
| Compound Name | 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-(dihydroxymethyl)cyclopropyl]methyl]-4-[(3-ethoxyphenyl)methyl]-3a,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,3]oxazole-5-carboxamide |
|---|---|
| PubChem CID | 123587834 |
| Molecular Formula | C32H34Cl2FN3O5 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 629.19 |
| IUPAC Name | 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-(dihydroxymethyl)cyclopropyl]methyl]-4-[(3-ethoxyphenyl)methyl]-3a,5,6,6a-tetrahydro-2H-pyrrolo[3,2-d][1,3]oxazole-5-carboxamide |
| SMILES | CCOc1cccc(CN2C3OCN(CC4CC4C(O)O)C3C(c3cccc(Cl)c3F)C2C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C32H34Cl2FN3O5/c1-2-42-22-9-3-6-18(12-22)15-38-28(30(39)36-21-8-4-7-20(33)14-21)26(23-10-5-11-25(34)27(23)35)29-31(38)43-17-37(29)16-19-13-24(19)32(40)41/h3-12,14,19,24,26,28-29,31-32,40-41H,2,13,15-17H2,1H3,(H,36,39) |
| InChIKey | AANSCAMSYPSMMA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|