C25H28Cl2FN3O3 — CID 123290379
6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-[hydroxy(methoxy)methyl]cyclopropyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-5-carboxamide (PubChem CID 123290379) has the molecular formula C25H28Cl2FN3O3 and a molecular weight of 508.42 g/mol. Its IUPAC name is 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-[hydroxy(methoxy)methyl]cyclopropyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-[hydroxy(methoxy)methyl]cyclopropyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 123290379 |
| Molecular Formula | C25H28Cl2FN3O3 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 6-(3-chloro-2-fluorophenyl)-N-(3-chlorophenyl)-1-[[2-[hydroxy(methoxy)methyl]cyclopropyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-5-carboxamide |
| SMILES | COC(O)C1CC1CN1CCC2NC(C(=O)Nc3cccc(Cl)c3)C(c3cccc(Cl)c3F)C21 |
| InChI | InChI=1S/C25H28Cl2FN3O3/c1-34-25(33)17-10-13(17)12-31-9-8-19-23(31)20(16-6-3-7-18(27)21(16)28)22(30-19)24(32)29-15-5-2-4-14(26)11-15/h2-7,11,13,17,19-20,22-23,25,30,33H,8-10,12H2,1H3,(H,29,32) |
| InChIKey | JNFSCHGGCUSORM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|