C33H31Cl2FN4O3 — CID 154999339
methyl (2S,3R,4R,6S)-3-(3-chloro-2-fluorophenyl)-4-[(3-chlorophenyl)carbamoyl]-5-(3-methylbut-2-enyl)-5,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),10(15),11,13-tetraene-13-carboxylate (PubChem CID 154999339) has the molecular formula C33H31Cl2FN4O3 and a molecular weight of 621.54 g/mol. Its IUPAC name is methyl (2S,3R,4R,6S)-3-(3-chloro-2-fluorophenyl)-4-[(3-chlorophenyl)carbamoyl]-5-(3-methylbut-2-enyl)-5,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),10(15),11,13-tetraene-13-carboxylate.
| Compound Name | methyl (2S,3R,4R,6S)-3-(3-chloro-2-fluorophenyl)-4-[(3-chlorophenyl)carbamoyl]-5-(3-methylbut-2-enyl)-5,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),10(15),11,13-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 154999339 |
| Molecular Formula | C33H31Cl2FN4O3 |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | methyl (2S,3R,4R,6S)-3-(3-chloro-2-fluorophenyl)-4-[(3-chlorophenyl)carbamoyl]-5-(3-methylbut-2-enyl)-5,9,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),10(15),11,13-tetraene-13-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc1n2CC[C@H]2[C@@H]1[C@H](c1cccc(Cl)c1F)[C@H](C(=O)Nc1cccc(Cl)c1)N2CC=C(C)C |
| InChI | InChI=1S/C33H31Cl2FN4O3/c1-18(2)12-14-39-26-13-15-40-25-11-10-19(33(42)43-3)16-24(25)38-31(40)28(26)27(22-8-5-9-23(35)29(22)36)30(39)32(41)37-21-7-4-6-20(34)17-21/h4-12,16-17,26-28,30H,13-15H2,1-3H3,(H,37,41)/t26-,27-,28+,30+/m0/s1 |
| InChIKey | LYXTYOHHPQNQDL-XIYUWPQBSA-N |
| XLogP | 7.20 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|