C34H35Cl2FN4O4 — CID 146426388
ethyl 2-[4-[(3R,3aS,7aS)-3-(3-chloro-2-fluorophenyl)-2-[(3-chlorophenyl)carbamoyl]-1-(cyclopropylmethyl)-4-oxo-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]anilino]acetate (PubChem CID 146426388) has the molecular formula C34H35Cl2FN4O4 and a molecular weight of 653.58 g/mol. Its IUPAC name is ethyl 2-[4-[(3R,3aS,7aS)-3-(3-chloro-2-fluorophenyl)-2-[(3-chlorophenyl)carbamoyl]-1-(cyclopropylmethyl)-4-oxo-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]anilino]acetate.
| Compound Name | ethyl 2-[4-[(3R,3aS,7aS)-3-(3-chloro-2-fluorophenyl)-2-[(3-chlorophenyl)carbamoyl]-1-(cyclopropylmethyl)-4-oxo-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]anilino]acetate |
|---|---|
| PubChem CID | 146426388 |
| Molecular Formula | C34H35Cl2FN4O4 |
| Molecular Weight | 653.58 g/mol |
| Exact Mass | 652.20 |
| IUPAC Name | ethyl 2-[4-[(3R,3aS,7aS)-3-(3-chloro-2-fluorophenyl)-2-[(3-chlorophenyl)carbamoyl]-1-(cyclopropylmethyl)-4-oxo-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]anilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(N2CC[C@H]3[C@@H](C2=O)[C@H](c2cccc(Cl)c2F)C(C(=O)Nc2cccc(Cl)c2)N3CC2CC2)cc1 |
| InChI | InChI=1S/C34H35Cl2FN4O4/c1-2-45-28(42)18-38-22-11-13-24(14-12-22)40-16-15-27-30(34(40)44)29(25-7-4-8-26(36)31(25)37)32(41(27)19-20-9-10-20)33(43)39-23-6-3-5-21(35)17-23/h3-8,11-14,17,20,27,29-30,32,38H,2,9-10,15-16,18-19H2,1H3,(H,39,43)/t27-,29-,30+,32?/m0/s1 |
| InChIKey | FFKXUBHLIHXBNI-LSTKSPHQSA-N |
| XLogP | 6.35 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |