C19H24ClFN2O — CID 138646711
3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-[(3-ethoxyphenyl)methyl]pyrrolidin-2-amine (PubChem CID 138646711) has the molecular formula C19H24ClFN2O and a molecular weight of 350.87 g/mol. Its IUPAC name is 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-[(3-ethoxyphenyl)methyl]pyrrolidin-2-amine.
| Compound Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-[(3-ethoxyphenyl)methyl]pyrrolidin-2-amine |
|---|---|
| PubChem CID | 138646711 |
| Molecular Formula | C19H24ClFN2O |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-[(3-ethoxyphenyl)methyl]pyrrolidin-2-amine |
| SMILES | C=C(Cl)/C=C\C=C(/F)C1CCN(Cc2cccc(OCC)c2)C1N |
| InChI | InChI=1S/C19H24ClFN2O/c1-3-24-16-8-5-7-15(12-16)13-23-11-10-17(19(23)22)18(21)9-4-6-14(2)20/h4-9,12,17,19H,2-3,10-11,13,22H2,1H3/b6-4-,18-9- |
| InChIKey | OCFMJPLRHMVVFP-UWOZGDMYSA-N |
| XLogP | 4.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|