C56H40N4S — CID 144989649
2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-phenanthren-9-ylphenyl)phenyl]phenyl]-7,8-dihydroquinoline;sulfane (PubChem CID 144989649) has the molecular formula C56H40N4S and a molecular weight of 801.03 g/mol. Its IUPAC name is 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-phenanthren-9-ylphenyl)phenyl]phenyl]-7,8-dihydroquinoline;sulfane.
| Compound Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-phenanthren-9-ylphenyl)phenyl]phenyl]-7,8-dihydroquinoline;sulfane |
|---|---|
| PubChem CID | 144989649 |
| Molecular Formula | C56H40N4S |
| Molecular Weight | 801.03 g/mol |
| Exact Mass | 800.30 |
| IUPAC Name | 2-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(3-phenanthren-9-ylphenyl)phenyl]phenyl]-7,8-dihydroquinoline;sulfane |
| SMILES | C1=Cc2ccc(-c3cccc(-c4cc(-c5cccc(-c6cc7ccccc7c7ccccc67)c5)cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)nc2CC1.S |
| InChI | InChI=1S/C56H38N4.H2S/c1-3-16-38(17-4-1)54-58-55(39-18-5-2-6-19-39)60-56(59-54)47-34-45(33-46(35-47)41-22-14-24-44(32-41)53-30-29-37-15-8-12-28-52(37)57-53)40-21-13-23-42(31-40)51-36-43-20-7-9-25-48(43)49-26-10-11-27-50(49)51;/h1-11,13-27,29-36H,12,28H2;1H2 |
| InChIKey | GGEQQGPIXVHTES-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.03 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|