C27H31N5O2S — CID 144991973
3-[[2-amino-3-(pyrrolidin-3-ylcarbamothioyl)-4-pyridinyl]oxy]-N-(3-methyl-4-propan-2-ylphenyl)benzamide (PubChem CID 144991973) has the molecular formula C27H31N5O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is 3-[[2-amino-3-(pyrrolidin-3-ylcarbamothioyl)-4-pyridinyl]oxy]-N-(3-methyl-4-propan-2-ylphenyl)benzamide.
| Compound Name | 3-[[2-amino-3-(pyrrolidin-3-ylcarbamothioyl)-4-pyridinyl]oxy]-N-(3-methyl-4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 144991973 |
| Molecular Formula | C27H31N5O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-[[2-amino-3-(pyrrolidin-3-ylcarbamothioyl)-4-pyridinyl]oxy]-N-(3-methyl-4-propan-2-ylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(Oc3ccnc(N)c3C(=S)NC3CCNC3)c2)ccc1C(C)C |
| InChI | InChI=1S/C27H31N5O2S/c1-16(2)22-8-7-19(13-17(22)3)31-26(33)18-5-4-6-21(14-18)34-23-10-12-30-25(28)24(23)27(35)32-20-9-11-29-15-20/h4-8,10,12-14,16,20,29H,9,11,15H2,1-3H3,(H2,28,30)(H,31,33)(H,32,35) |
| InChIKey | INMWDJUZTIBRQN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|