C22H22BrN5O2 — CID 70791648
N-[4-[[2-amino-3-(1,3-diazinan-2-yl)-4-pyridinyl]oxy]phenyl]-3-bromobenzamide (PubChem CID 70791648) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is N-[4-[[2-amino-3-(1,3-diazinan-2-yl)-4-pyridinyl]oxy]phenyl]-3-bromobenzamide.
| Compound Name | N-[4-[[2-amino-3-(1,3-diazinan-2-yl)-4-pyridinyl]oxy]phenyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 70791648 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-[4-[[2-amino-3-(1,3-diazinan-2-yl)-4-pyridinyl]oxy]phenyl]-3-bromobenzamide |
| SMILES | Nc1nccc(Oc2ccc(NC(=O)c3cccc(Br)c3)cc2)c1C1NCCCN1 |
| InChI | InChI=1S/C22H22BrN5O2/c23-15-4-1-3-14(13-15)22(29)28-16-5-7-17(8-6-16)30-18-9-12-25-20(24)19(18)21-26-10-2-11-27-21/h1,3-9,12-13,21,26-27H,2,10-11H2,(H2,24,25)(H,28,29) |
| InChIKey | LOJRRLLPFUQFKS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |