C36H41FN6O5S — CID 144993849
[2-cyclopropyl-7-[8-[(1,8-dioxo-9-phenylmethoxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-8-oxooctanoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite (PubChem CID 144993849) has the molecular formula C36H41FN6O5S and a molecular weight of 688.83 g/mol. Its IUPAC name is [2-cyclopropyl-7-[8-[(1,8-dioxo-9-phenylmethoxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-8-oxooctanoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite.
| Compound Name | [2-cyclopropyl-7-[8-[(1,8-dioxo-9-phenylmethoxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-8-oxooctanoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
|---|---|
| PubChem CID | 144993849 |
| Molecular Formula | C36H41FN6O5S |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.28 |
| IUPAC Name | [2-cyclopropyl-7-[8-[(1,8-dioxo-9-phenylmethoxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-8-oxooctanoyl]pyrrolo[2,3-b]pyrazin-5-yl] thiohypofluorite |
| SMILES | CC(C)N1CCn2c(CNC(=O)CCCCCCC(=O)c3cn(SF)c4ncc(C5CC5)nc34)cc(=O)c(OCc3ccccc3)c2C1=O |
| InChI | InChI=1S/C36H41FN6O5S/c1-23(2)41-16-17-42-26(18-30(45)34(33(42)36(41)47)48-22-24-10-6-5-7-11-24)19-38-31(46)13-9-4-3-8-12-29(44)27-21-43(49-37)35-32(27)40-28(20-39-35)25-14-15-25/h5-7,10-11,18,20-21,23,25H,3-4,8-9,12-17,19,22H2,1-2H3,(H,38,46) |
| InChIKey | FHTNFZXFQZCNIY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|