C19H34O3 — CID 144994306
3-tert-butyl-4-(2-tert-butyl-4-methylhexyl)oxolane-2,5-dione (PubChem CID 144994306) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 3-tert-butyl-4-(2-tert-butyl-4-methylhexyl)oxolane-2,5-dione.
| Compound Name | 3-tert-butyl-4-(2-tert-butyl-4-methylhexyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 144994306 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 3-tert-butyl-4-(2-tert-butyl-4-methylhexyl)oxolane-2,5-dione |
| SMILES | CCC(C)CC(CC1C(=O)OC(=O)C1C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3/c1-9-12(2)10-13(18(3,4)5)11-14-15(19(6,7)8)17(21)22-16(14)20/h12-15H,9-11H2,1-8H3 |
| InChIKey | BKYLZGGHVHNEQN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|