About (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate
(1-ethylcyclohexyl) (E)-6-oxohept-2-enoate (PubChem CID 144994530) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate.
Molecular Properties
| Compound Name | (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate |
| PubChem CID | 144994530 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate |
| SMILES | CCC1(OC(=O)/C=C/CCC(C)=O)CCCCC1 |
| InChI | InChI=1S/C15H24O3/c1-3-15(11-7-4-8-12-15)18-14(17)10-6-5-9-13(2)16/h6,10H,3-5,7-9,11-12H2,1-2H3/b10-6+ |
| InChIKey | RXSNTGDDVXTXLE-UXBLZVDNSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate?
The IUPAC name of (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate (CID 144994530) is (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate.
What is the SMILES notation for (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate?
The canonical SMILES for (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate is CCC1(OC(=O)/C=C/CCC(C)=O)CCCCC1.
What is the InChIKey of (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate?
The InChIKey is RXSNTGDDVXTXLE-UXBLZVDNSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-15(11-7-4-8-12-15)18-14(17)10-6-5-9-13(2)16/h6,10H,3-5,7-9,11-12H2,1-2H3/b10-6+.
What are the key properties of (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate?
(1-ethylcyclohexyl) (E)-6-oxohept-2-enoate has a molecular weight of 252.35 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclohexyl) (E)-6-oxohept-2-enoate is sourced from PubChem (CID 144994530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).