C32H31N3O4S2 — CID 144994678
2-(4-carboxy-2-pyridinyl)-6-[4-(5-hexyl-2-thiophen-2-ylthiophen-3-yl)-2-pyridinyl]-1-methyl-2H-pyridine-4-carboxylic acid (PubChem CID 144994678) has the molecular formula C32H31N3O4S2 and a molecular weight of 585.75 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-6-[4-(5-hexyl-2-thiophen-2-ylthiophen-3-yl)-2-pyridinyl]-1-methyl-2H-pyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-6-[4-(5-hexyl-2-thiophen-2-ylthiophen-3-yl)-2-pyridinyl]-1-methyl-2H-pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 144994678 |
| Molecular Formula | C32H31N3O4S2 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-6-[4-(5-hexyl-2-thiophen-2-ylthiophen-3-yl)-2-pyridinyl]-1-methyl-2H-pyridine-4-carboxylic acid |
| SMILES | CCCCCCc1cc(-c2ccnc(C3=CC(C(=O)O)=CC(c4cc(C(=O)O)ccn4)N3C)c2)c(-c2cccs2)s1 |
| InChI | InChI=1S/C32H31N3O4S2/c1-3-4-5-6-8-23-19-24(30(41-23)29-9-7-14-40-29)20-10-12-33-25(15-20)27-17-22(32(38)39)18-28(35(27)2)26-16-21(31(36)37)11-13-34-26/h7,9-19,28H,3-6,8H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | HFZOGVSBCSFBRT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|