C12H19F3 — CID 144996123
1,3,5-trifluoro-3,7,7-trimethylbicyclo[3.3.1]nonane (PubChem CID 144996123) has the molecular formula C12H19F3 and a molecular weight of 220.28 g/mol. Its IUPAC name is 1,3,5-trifluoro-3,7,7-trimethylbicyclo[3.3.1]nonane.
| Compound Name | 1,3,5-trifluoro-3,7,7-trimethylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 144996123 |
| Molecular Formula | C12H19F3 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1,3,5-trifluoro-3,7,7-trimethylbicyclo[3.3.1]nonane |
| SMILES | CC1(C)CC2(F)CC(C)(F)CC(F)(C1)C2 |
| InChI | InChI=1S/C12H19F3/c1-9(2)4-11(14)6-10(3,13)7-12(15,5-9)8-11/h4-8H2,1-3H3 |
| InChIKey | LRZIQJLVSDVNBV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |