C10H19F2N — CID 123247784
3,3-difluoro-N,1,5,5-tetramethylcyclohexan-1-amine (PubChem CID 123247784) has the molecular formula C10H19F2N and a molecular weight of 191.26 g/mol. Its IUPAC name is 3,3-difluoro-N,1,5,5-tetramethylcyclohexan-1-amine.
| Compound Name | 3,3-difluoro-N,1,5,5-tetramethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 123247784 |
| Molecular Formula | C10H19F2N |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 3,3-difluoro-N,1,5,5-tetramethylcyclohexan-1-amine |
| SMILES | CNC1(C)CC(C)(C)CC(F)(F)C1 |
| InChI | InChI=1S/C10H19F2N/c1-8(2)5-9(3,13-4)7-10(11,12)6-8/h13H,5-7H2,1-4H3 |
| InChIKey | AZQAOOLYFYFWDH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |