C13H21F — CID 23235267
1-fluoro-3,5,7-trimethyladamantane (PubChem CID 23235267) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is 1-fluoro-3,5,7-trimethyladamantane.
| Compound Name | 1-fluoro-3,5,7-trimethyladamantane |
|---|---|
| PubChem CID | 23235267 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-fluoro-3,5,7-trimethyladamantane |
| SMILES | CC12CC3(C)CC(C)(C1)CC(F)(C2)C3 |
| InChI | InChI=1S/C13H21F/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11/h4-9H2,1-3H3 |
| InChIKey | FKULXVPDCAZIIX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |